About N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide
N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide (PubChem CID 11291861) has the molecular formula C23H23NO2S
and a molecular weight of 377.51 g/mol. Its IUPAC name is N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide |
| PubChem CID | 11291861 |
| Molecular Formula | C23H23NO2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(NS(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO2S/c1-3-22(18-10-6-4-7-11-18)23(19-12-8-5-9-13-19)20-14-16-21(17-15-20)24-27(2,25)26/h4-17,24H,3H2,1-2H3/b23-22- |
| InChIKey | GPAKLHBYXNOZRQ-FCQUAONHSA-N |
| XLogP | 5.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide?
The IUPAC name of N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide (CID 11291861) is N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide?
The canonical SMILES for N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide is CC/C(=C(\c1ccccc1)c1ccc(NS(C)(=O)=O)cc1)c1ccccc1.
What is the InChIKey of N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide?
The InChIKey is GPAKLHBYXNOZRQ-FCQUAONHSA-N. The full InChI is InChI=1S/C23H23NO2S/c1-3-22(18-10-6-4-7-11-18)23(19-12-8-5-9-13-19)20-14-16-21(17-15-20)24-27(2,25)26/h4-17,24H,3H2,1-2H3/b23-22-.
What are the key properties of N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide?
N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide has a molecular weight of 377.51 g/mol, XLogP of 5.43, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]methanesulfonamide is sourced from PubChem (CID 11291861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).