C20H25N7O — CID 11291914
4-[[2-[2-(diaminomethylideneamino)ethyl]-3-oxo-2,5-dihydro-1H-1,4-benzodiazepin-4-yl]methyl]benzenecarboximidamide (PubChem CID 11291914) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is 4-[[2-[2-(diaminomethylideneamino)ethyl]-3-oxo-2,5-dihydro-1H-1,4-benzodiazepin-4-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-[[2-[2-(diaminomethylideneamino)ethyl]-3-oxo-2,5-dihydro-1H-1,4-benzodiazepin-4-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 11291914 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 4-[[2-[2-(diaminomethylideneamino)ethyl]-3-oxo-2,5-dihydro-1H-1,4-benzodiazepin-4-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2Cc3ccccc3NC(CCN=C(N)N)C2=O)cc1 |
| InChI | InChI=1S/C20H25N7O/c21-18(22)14-7-5-13(6-8-14)11-27-12-15-3-1-2-4-16(15)26-17(19(27)28)9-10-25-20(23)24/h1-8,17,26H,9-12H2,(H3,21,22)(H4,23,24,25) |
| InChIKey | XXTYJQUSYYVSAK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|