C22H40O3Si — CID 11291954
2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(1S,6R)-6-(hydroxymethyl)-6-methylcyclohex-3-en-1-yl]ethyl]cyclohex-2-en-1-ol (PubChem CID 11291954) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is 2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(1S,6R)-6-(hydroxymethyl)-6-methylcyclohex-3-en-1-yl]ethyl]cyclohex-2-en-1-ol.
| Compound Name | 2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(1S,6R)-6-(hydroxymethyl)-6-methylcyclohex-3-en-1-yl]ethyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 11291954 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(1S,6R)-6-(hydroxymethyl)-6-methylcyclohex-3-en-1-yl]ethyl]cyclohex-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C[C@@H]1CC=CC[C@@]1(C)CO)C1=CCCCC1O |
| InChI | InChI=1S/C22H40O3Si/c1-21(2,3)26(5,6)25-20(18-12-7-8-13-19(18)24)15-17-11-9-10-14-22(17,4)16-23/h9-10,12,17,19-20,23-24H,7-8,11,13-16H2,1-6H3/t17-,19?,20+,22-/m0/s1 |
| InChIKey | SNHMSSSFCVLEIW-NRFIUKIUSA-N |
| XLogP | 5.20 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|