C22H18Cl2N2 — CID 11291964
2,4-bis(4-chlorophenyl)-2-methyl-1,3-dihydro-1,5-benzodiazepine (PubChem CID 11291964) has the molecular formula C22H18Cl2N2 and a molecular weight of 381.31 g/mol. Its IUPAC name is 2,4-bis(4-chlorophenyl)-2-methyl-1,3-dihydro-1,5-benzodiazepine.
| Compound Name | 2,4-bis(4-chlorophenyl)-2-methyl-1,3-dihydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 11291964 |
| Molecular Formula | C22H18Cl2N2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2,4-bis(4-chlorophenyl)-2-methyl-1,3-dihydro-1,5-benzodiazepine |
| SMILES | CC1(c2ccc(Cl)cc2)CC(c2ccc(Cl)cc2)=Nc2ccccc2N1 |
| InChI | InChI=1S/C22H18Cl2N2/c1-22(16-8-12-18(24)13-9-16)14-21(15-6-10-17(23)11-7-15)25-19-4-2-3-5-20(19)26-22/h2-13,26H,14H2,1H3 |
| InChIKey | DONGAHJEMQRHEA-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |