C21H25N7 — CID 112920054
6-methyl-N-(2-phenylethyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112920054) has the molecular formula C21H25N7 and a molecular weight of 375.48 g/mol. Its IUPAC name is 6-methyl-N-(2-phenylethyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | 6-methyl-N-(2-phenylethyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112920054 |
| Molecular Formula | C21H25N7 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 6-methyl-N-(2-phenylethyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(NCCc2ccccc2)nc(N2CCN(c3ncccn3)CC2)n1 |
| InChI | InChI=1S/C21H25N7/c1-17-16-19(22-11-8-18-6-3-2-4-7-18)26-21(25-17)28-14-12-27(13-15-28)20-23-9-5-10-24-20/h2-7,9-10,16H,8,11-15H2,1H3,(H,22,25,26) |
| InChIKey | OAWPNYBXZOUMGW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |