About [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol
[1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol (PubChem CID 11292051) has the molecular formula C16H20N2O5S2
and a molecular weight of 384.48 g/mol. Its IUPAC name is [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol.
Molecular Properties
| Compound Name | [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol |
| PubChem CID | 11292051 |
| Molecular Formula | C16H20N2O5S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol |
| SMILES | CS(=O)(=O)c1ccc(-c2cc(CO)nn2C2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C16H20N2O5S2/c1-24(20,21)15-4-2-12(3-5-15)16-10-13(11-19)17-18(16)14-6-8-25(22,23)9-7-14/h2-5,10,14,19H,6-9,11H2,1H3 |
| InChIKey | CSWXUQMHUVWOAN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol?
The IUPAC name of [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol (CID 11292051) is [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol.
What is the SMILES notation for [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol?
The canonical SMILES for [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol is CS(=O)(=O)c1ccc(-c2cc(CO)nn2C2CCS(=O)(=O)CC2)cc1.
What is the InChIKey of [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol?
The InChIKey is CSWXUQMHUVWOAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O5S2/c1-24(20,21)15-4-2-12(3-5-15)16-10-13(11-19)17-18(16)14-6-8-25(22,23)9-7-14/h2-5,10,14,19H,6-9,11H2,1H3.
What are the key properties of [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol?
[1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol has a molecular weight of 384.48 g/mol, XLogP of 1.20, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,1-dioxothian-4-yl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanol is sourced from PubChem (CID 11292051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).