C18H9F3N2O3S — CID 11292212
2-[3-(4,5,7-trifluoro-1,3-benzothiazole-2-carbonyl)indol-1-yl]acetic acid (PubChem CID 11292212) has the molecular formula C18H9F3N2O3S and a molecular weight of 390.34 g/mol. Its IUPAC name is 2-[3-(4,5,7-trifluoro-1,3-benzothiazole-2-carbonyl)indol-1-yl]acetic acid.
| Compound Name | 2-[3-(4,5,7-trifluoro-1,3-benzothiazole-2-carbonyl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 11292212 |
| Molecular Formula | C18H9F3N2O3S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 2-[3-(4,5,7-trifluoro-1,3-benzothiazole-2-carbonyl)indol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(C(=O)c2nc3c(F)c(F)cc(F)c3s2)c2ccccc21 |
| InChI | InChI=1S/C18H9F3N2O3S/c19-10-5-11(20)17-15(14(10)21)22-18(27-17)16(26)9-6-23(7-13(24)25)12-4-2-1-3-8(9)12/h1-6H,7H2,(H,24,25) |
| InChIKey | LAFPEARAJSRTIU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|