C22H25F3N2O — CID 11292219
3,3-dimethyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]butanamide (PubChem CID 11292219) has the molecular formula C22H25F3N2O and a molecular weight of 390.45 g/mol. Its IUPAC name is 3,3-dimethyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]butanamide.
| Compound Name | 3,3-dimethyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]butanamide |
|---|---|
| PubChem CID | 11292219 |
| Molecular Formula | C22H25F3N2O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3,3-dimethyl-N-[1-[[4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]butanamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc2c(c1)CCN2Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H25F3N2O/c1-21(2,3)13-20(28)26-18-8-9-19-16(12-18)10-11-27(19)14-15-4-6-17(7-5-15)22(23,24)25/h4-9,12H,10-11,13-14H2,1-3H3,(H,26,28) |
| InChIKey | LPANCCTYLFDVAL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|