C21H29N5O2 — CID 112923752
[4-[2-(cycloheptylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 112923752) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is [4-[2-(cycloheptylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[2-(cycloheptylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 112923752 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | [4-[2-(cycloheptylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | Cc1cc(N2CCN(C(=O)c3ccco3)CC2)nc(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C21H29N5O2/c1-16-15-19(24-21(22-16)23-17-7-4-2-3-5-8-17)25-10-12-26(13-11-25)20(27)18-9-6-14-28-18/h6,9,14-15,17H,2-5,7-8,10-13H2,1H3,(H,22,23,24) |
| InChIKey | VKBBWZMXAXMFFN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |