About 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide
5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide (PubChem CID 11292460) has the molecular formula C26H23FN2O
and a molecular weight of 398.48 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide |
| PubChem CID | 11292460 |
| Molecular Formula | C26H23FN2O |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide |
| SMILES | CC(C)c1[nH]c(-c2ccc(F)cc2)c(-c2ccccc2)c1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H23FN2O/c1-17(2)24-23(26(30)28-21-11-7-4-8-12-21)22(18-9-5-3-6-10-18)25(29-24)19-13-15-20(27)16-14-19/h3-17,29H,1-2H3,(H,28,30) |
| InChIKey | VVWQXUVEGUGGOY-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide?
The IUPAC name of 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide (CID 11292460) is 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide.
What is the SMILES notation for 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide?
The canonical SMILES for 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide is CC(C)c1[nH]c(-c2ccc(F)cc2)c(-c2ccccc2)c1C(=O)Nc1ccccc1.
What is the InChIKey of 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide?
The InChIKey is VVWQXUVEGUGGOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23FN2O/c1-17(2)24-23(26(30)28-21-11-7-4-8-12-21)22(18-9-5-3-6-10-18)25(29-24)19-13-15-20(27)16-14-19/h3-17,29H,1-2H3,(H,28,30).
What are the key properties of 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide?
5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide has a molecular weight of 398.48 g/mol, XLogP of 6.86, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1H-pyrrole-3-carboxamide is sourced from PubChem (CID 11292460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).