About N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine
N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine (PubChem CID 112925677) has the molecular formula C19H26N4
and a molecular weight of 310.45 g/mol. Its IUPAC name is N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine |
| PubChem CID | 112925677 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine |
| SMILES | CCCCN(C)c1cc(C)nc(N2c3ccccc3CC2C)n1 |
| InChI | InChI=1S/C19H26N4/c1-5-6-11-22(4)18-12-14(2)20-19(21-18)23-15(3)13-16-9-7-8-10-17(16)23/h7-10,12,15H,5-6,11,13H2,1-4H3 |
| InChIKey | WCDQEAWCCAHDTH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine?
The IUPAC name of N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine (CID 112925677) is N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine.
What is the SMILES notation for N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine?
The canonical SMILES for N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine is CCCCN(C)c1cc(C)nc(N2c3ccccc3CC2C)n1.
What is the InChIKey of N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine?
The InChIKey is WCDQEAWCCAHDTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4/c1-5-6-11-22(4)18-12-14(2)20-19(21-18)23-15(3)13-16-9-7-8-10-17(16)23/h7-10,12,15H,5-6,11,13H2,1-4H3.
What are the key properties of N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine?
N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine has a molecular weight of 310.45 g/mol, XLogP of 4.10, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N,6-dimethyl-2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-amine is sourced from PubChem (CID 112925677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).