C21H28N4O2 — CID 112926026
ethyl 4-[[2-(2-ethylpiperidin-1-yl)-6-methylpyrimidin-4-yl]amino]benzoate (PubChem CID 112926026) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is ethyl 4-[[2-(2-ethylpiperidin-1-yl)-6-methylpyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(2-ethylpiperidin-1-yl)-6-methylpyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112926026 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | ethyl 4-[[2-(2-ethylpiperidin-1-yl)-6-methylpyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2cc(C)nc(N3CCCCC3CC)n2)cc1 |
| InChI | InChI=1S/C21H28N4O2/c1-4-18-8-6-7-13-25(18)21-22-15(3)14-19(24-21)23-17-11-9-16(10-12-17)20(26)27-5-2/h9-12,14,18H,4-8,13H2,1-3H3,(H,22,23,24) |
| InChIKey | JMGPSRKMEKZKFP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |