C17H21BrN4 — CID 112926236
N-(2-bromophenyl)-6-methyl-2-(3-methylpiperidin-1-yl)pyrimidin-4-amine (PubChem CID 112926236) has the molecular formula C17H21BrN4 and a molecular weight of 361.29 g/mol. Its IUPAC name is N-(2-bromophenyl)-6-methyl-2-(3-methylpiperidin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(2-bromophenyl)-6-methyl-2-(3-methylpiperidin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112926236 |
| Molecular Formula | C17H21BrN4 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-(2-bromophenyl)-6-methyl-2-(3-methylpiperidin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccccc2Br)nc(N2CCCC(C)C2)n1 |
| InChI | InChI=1S/C17H21BrN4/c1-12-6-5-9-22(11-12)17-19-13(2)10-16(21-17)20-15-8-4-3-7-14(15)18/h3-4,7-8,10,12H,5-6,9,11H2,1-2H3,(H,19,20,21) |
| InChIKey | KAIGMBOAHNNPGW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |