C18H23N5 — CID 112926360
4-[[4-(dipropylamino)-6-methylpyrimidin-2-yl]amino]benzonitrile (PubChem CID 112926360) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 4-[[4-(dipropylamino)-6-methylpyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-(dipropylamino)-6-methylpyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112926360 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 4-[[4-(dipropylamino)-6-methylpyrimidin-2-yl]amino]benzonitrile |
| SMILES | CCCN(CCC)c1cc(C)nc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C18H23N5/c1-4-10-23(11-5-2)17-12-14(3)20-18(22-17)21-16-8-6-15(13-19)7-9-16/h6-9,12H,4-5,10-11H2,1-3H3,(H,20,21,22) |
| InChIKey | URMVTMIXJDWFOQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |