C22H26N6O2 — CID 11292679
1-N,4-N-diphenyl-3,6-dipropyl-1,2,4,5-tetrazine-1,4-dicarboxamide (PubChem CID 11292679) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-N,4-N-diphenyl-3,6-dipropyl-1,2,4,5-tetrazine-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-diphenyl-3,6-dipropyl-1,2,4,5-tetrazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 11292679 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 1-N,4-N-diphenyl-3,6-dipropyl-1,2,4,5-tetrazine-1,4-dicarboxamide |
| SMILES | CCCC1=NN(C(=O)Nc2ccccc2)C(CCC)=NN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H26N6O2/c1-3-11-19-25-28(22(30)24-18-15-9-6-10-16-18)20(12-4-2)26-27(19)21(29)23-17-13-7-5-8-14-17/h5-10,13-16H,3-4,11-12H2,1-2H3,(H,23,29)(H,24,30) |
| InChIKey | RGVBQORKFNUZPQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |