C19H17BrN4 — CID 112927693
N-(4-bromophenyl)-4-(2,3-dihydroindol-1-yl)-6-methylpyrimidin-2-amine (PubChem CID 112927693) has the molecular formula C19H17BrN4 and a molecular weight of 381.28 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-(2,3-dihydroindol-1-yl)-6-methylpyrimidin-2-amine.
| Compound Name | N-(4-bromophenyl)-4-(2,3-dihydroindol-1-yl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112927693 |
| Molecular Formula | C19H17BrN4 |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-(4-bromophenyl)-4-(2,3-dihydroindol-1-yl)-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCc3ccccc32)nc(Nc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C19H17BrN4/c1-13-12-18(24-11-10-14-4-2-3-5-17(14)24)23-19(21-13)22-16-8-6-15(20)7-9-16/h2-9,12H,10-11H2,1H3,(H,21,22,23) |
| InChIKey | WQNDRWCJUSKXGG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |