C19H30O8Si — CID 11292899
[(1S,5R,6S)-5,6-diacetyloxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] acetate (PubChem CID 11292899) has the molecular formula C19H30O8Si and a molecular weight of 414.53 g/mol. Its IUPAC name is [(1S,5R,6S)-5,6-diacetyloxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,5R,6S)-5,6-diacetyloxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 11292899 |
| Molecular Formula | C19H30O8Si |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [(1S,5R,6S)-5,6-diacetyloxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxocyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)C=C(CO[Si](C)(C)C(C)(C)C)C(=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H30O8Si/c1-11(20)25-15-9-14(10-24-28(7,8)19(4,5)6)16(23)18(27-13(3)22)17(15)26-12(2)21/h9,15,17-18H,10H2,1-8H3/t15-,17-,18-/m0/s1 |
| InChIKey | DLLBHPJJYVYOSC-SZMVWBNQSA-N |
| XLogP | 2.31 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|