C24H21N3O4 — CID 11292923
1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-phenylurea (PubChem CID 11292923) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-phenylurea.
| Compound Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-phenylurea |
|---|---|
| PubChem CID | 11292923 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-phenylurea |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)Nc4ccccc4)cc3)c2cc1OC |
| InChI | InChI=1S/C24H21N3O4/c1-29-22-14-19-20(15-23(22)30-2)25-13-12-21(19)31-18-10-8-17(9-11-18)27-24(28)26-16-6-4-3-5-7-16/h3-15H,1-2H3,(H2,26,27,28) |
| InChIKey | DRBIGHXBYOJZLO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |