C19H16ClN5 — CID 112930011
4-[[2-(5-chloro-2-methylanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112930011) has the molecular formula C19H16ClN5 and a molecular weight of 349.83 g/mol. Its IUPAC name is 4-[[2-(5-chloro-2-methylanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 4-[[2-(5-chloro-2-methylanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112930011 |
| Molecular Formula | C19H16ClN5 |
| Molecular Weight | 349.83 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-[[2-(5-chloro-2-methylanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | Cc1cc(Nc2ccc(C#N)cc2)nc(Nc2cc(Cl)ccc2C)n1 |
| InChI | InChI=1S/C19H16ClN5/c1-12-3-6-15(20)10-17(12)24-19-22-13(2)9-18(25-19)23-16-7-4-14(11-21)5-8-16/h3-10H,1-2H3,(H2,22,23,24,25) |
| InChIKey | NABCCMFGBDBRLH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.83 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |