C23H42O3Si2 — CID 11293134
tert-butyl-[(3R)-6-[tert-butyl(dimethyl)silyl]-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-1,5-diyn-3-yl]oxy-dimethylsilane (PubChem CID 11293134) has the molecular formula C23H42O3Si2 and a molecular weight of 422.76 g/mol. Its IUPAC name is tert-butyl-[(3R)-6-[tert-butyl(dimethyl)silyl]-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-1,5-diyn-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R)-6-[tert-butyl(dimethyl)silyl]-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-1,5-diyn-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11293134 |
| Molecular Formula | C23H42O3Si2 |
| Molecular Weight | 422.76 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | tert-butyl-[(3R)-6-[tert-butyl(dimethyl)silyl]-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-1,5-diyn-3-yl]oxy-dimethylsilane |
| SMILES | C#C[C@@](CC#C[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C23H42O3Si2/c1-14-23(19-18-24-22(8,9)25-19,26-28(12,13)21(5,6)7)16-15-17-27(10,11)20(2,3)4/h1,19H,16,18H2,2-13H3/t19-,23+/m1/s1 |
| InChIKey | LGXLACVNNMOEEQ-XXBNENTESA-N |
| XLogP | 5.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.76 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|