C21H23N5O2 — CID 112931594
methyl 2-[[4-[4-(dimethylamino)anilino]-6-methylpyrimidin-2-yl]amino]benzoate (PubChem CID 112931594) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is methyl 2-[[4-[4-(dimethylamino)anilino]-6-methylpyrimidin-2-yl]amino]benzoate.
| Compound Name | methyl 2-[[4-[4-(dimethylamino)anilino]-6-methylpyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 112931594 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | methyl 2-[[4-[4-(dimethylamino)anilino]-6-methylpyrimidin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1nc(C)cc(Nc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C21H23N5O2/c1-14-13-19(23-15-9-11-16(12-10-15)26(2)3)25-21(22-14)24-18-8-6-5-7-17(18)20(27)28-4/h5-13H,1-4H3,(H2,22,23,24,25) |
| InChIKey | MVHNROZHOGYGGS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|