C19H16F2N4O2 — CID 112931655
methyl 4-[[2-(2,6-difluoroanilino)-6-methylpyrimidin-4-yl]amino]benzoate (PubChem CID 112931655) has the molecular formula C19H16F2N4O2 and a molecular weight of 370.36 g/mol. Its IUPAC name is methyl 4-[[2-(2,6-difluoroanilino)-6-methylpyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[2-(2,6-difluoroanilino)-6-methylpyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112931655 |
| Molecular Formula | C19H16F2N4O2 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | methyl 4-[[2-(2,6-difluoroanilino)-6-methylpyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2cc(C)nc(Nc3c(F)cccc3F)n2)cc1 |
| InChI | InChI=1S/C19H16F2N4O2/c1-11-10-16(23-13-8-6-12(7-9-13)18(26)27-2)24-19(22-11)25-17-14(20)4-3-5-15(17)21/h3-10H,1-2H3,(H2,22,23,24,25) |
| InChIKey | LREVZYDCEBAPFI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |