C21H16F3N5O2 — CID 11293252
2-ethyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)-6-phenyl-4-(3,4,5-trifluoroanilino)pyridazin-3-one (PubChem CID 11293252) has the molecular formula C21H16F3N5O2 and a molecular weight of 427.39 g/mol. Its IUPAC name is 2-ethyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)-6-phenyl-4-(3,4,5-trifluoroanilino)pyridazin-3-one.
| Compound Name | 2-ethyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)-6-phenyl-4-(3,4,5-trifluoroanilino)pyridazin-3-one |
|---|---|
| PubChem CID | 11293252 |
| Molecular Formula | C21H16F3N5O2 |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-ethyl-5-(5-methyl-1,3,4-oxadiazol-2-yl)-6-phenyl-4-(3,4,5-trifluoroanilino)pyridazin-3-one |
| SMILES | CCn1nc(-c2ccccc2)c(-c2nnc(C)o2)c(Nc2cc(F)c(F)c(F)c2)c1=O |
| InChI | InChI=1S/C21H16F3N5O2/c1-3-29-21(30)19(25-13-9-14(22)17(24)15(23)10-13)16(20-27-26-11(2)31-20)18(28-29)12-7-5-4-6-8-12/h4-10,25H,3H2,1-2H3 |
| InChIKey | ANAZDCIIOKPEKT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|