C19H28N4 — CID 112932852
6-phenyl-2-N-propan-2-yl-4-N,4-N-dipropylpyrimidine-2,4-diamine (PubChem CID 112932852) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is 6-phenyl-2-N-propan-2-yl-4-N,4-N-dipropylpyrimidine-2,4-diamine.
| Compound Name | 6-phenyl-2-N-propan-2-yl-4-N,4-N-dipropylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112932852 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 6-phenyl-2-N-propan-2-yl-4-N,4-N-dipropylpyrimidine-2,4-diamine |
| SMILES | CCCN(CCC)c1cc(-c2ccccc2)nc(NC(C)C)n1 |
| InChI | InChI=1S/C19H28N4/c1-5-12-23(13-6-2)18-14-17(16-10-8-7-9-11-16)21-19(22-18)20-15(3)4/h7-11,14-15H,5-6,12-13H2,1-4H3,(H,20,21,22) |
| InChIKey | VIMMXJPAELFMLG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |