C20H24N4O2 — CID 112933291
2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-6-phenyl-N-prop-2-enylpyrimidin-4-amine (PubChem CID 112933291) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-6-phenyl-N-prop-2-enylpyrimidin-4-amine.
| Compound Name | 2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-6-phenyl-N-prop-2-enylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112933291 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-6-phenyl-N-prop-2-enylpyrimidin-4-amine |
| SMILES | C=CCNc1cc(-c2ccccc2)nc(N2CCC3(CC2)OCCO3)n1 |
| InChI | InChI=1S/C20H24N4O2/c1-2-10-21-18-15-17(16-6-4-3-5-7-16)22-19(23-18)24-11-8-20(9-12-24)25-13-14-26-20/h2-7,15H,1,8-14H2,(H,21,22,23) |
| InChIKey | FKQMNNKHBQINBQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|