About 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one
3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one (PubChem CID 11293351) has the molecular formula C24H15ClN2O2S
and a molecular weight of 430.92 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one |
| PubChem CID | 11293351 |
| Molecular Formula | C24H15ClN2O2S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c(-c3ccccc3)c(-c3ccccc3)oc2[nH]c(=S)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15ClN2O2S/c25-17-11-13-18(14-12-17)27-23(28)20-19(15-7-3-1-4-8-15)21(16-9-5-2-6-10-16)29-22(20)26-24(27)30/h1-14H,(H,26,30) |
| InChIKey | PSTSZVOORIRTAK-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 50.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one?
The IUPAC name of 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one (CID 11293351) is 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one is O=c1c2c(-c3ccccc3)c(-c3ccccc3)oc2[nH]c(=S)n1-c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one?
The InChIKey is PSTSZVOORIRTAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15ClN2O2S/c25-17-11-13-18(14-12-17)27-23(28)20-19(15-7-3-1-4-8-15)21(16-9-5-2-6-10-16)29-22(20)26-24(27)30/h1-14H,(H,26,30).
What are the key properties of 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one?
3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one has a molecular weight of 430.92 g/mol, XLogP of 6.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-5,6-diphenyl-2-sulfanylidene-1H-furo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 11293351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).