C22H22N4 — CID 112933523
4-(2-methyl-2,3-dihydroindol-1-yl)-6-phenyl-N-prop-2-enylpyrimidin-2-amine (PubChem CID 112933523) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is 4-(2-methyl-2,3-dihydroindol-1-yl)-6-phenyl-N-prop-2-enylpyrimidin-2-amine.
| Compound Name | 4-(2-methyl-2,3-dihydroindol-1-yl)-6-phenyl-N-prop-2-enylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112933523 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-(2-methyl-2,3-dihydroindol-1-yl)-6-phenyl-N-prop-2-enylpyrimidin-2-amine |
| SMILES | C=CCNc1nc(-c2ccccc2)cc(N2c3ccccc3CC2C)n1 |
| InChI | InChI=1S/C22H22N4/c1-3-13-23-22-24-19(17-9-5-4-6-10-17)15-21(25-22)26-16(2)14-18-11-7-8-12-20(18)26/h3-12,15-16H,1,13-14H2,2H3,(H,23,24,25) |
| InChIKey | OBVRVVDITMDHDE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|