C22H22N4O2 — CID 112934184
methyl 3-[(4-phenyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]benzoate (PubChem CID 112934184) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is methyl 3-[(4-phenyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]benzoate.
| Compound Name | methyl 3-[(4-phenyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 112934184 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | methyl 3-[(4-phenyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2nc(-c3ccccc3)cc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C22H22N4O2/c1-28-21(27)17-10-7-11-18(14-17)23-22-24-19(16-8-3-2-4-9-16)15-20(25-22)26-12-5-6-13-26/h2-4,7-11,14-15H,5-6,12-13H2,1H3,(H,23,24,25) |
| InChIKey | IZPZVWAJYUDZAI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |