C22H24N4O — CID 112934233
N-[(2-methoxyphenyl)methyl]-6-phenyl-2-pyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 112934233) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-6-phenyl-2-pyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | N-[(2-methoxyphenyl)methyl]-6-phenyl-2-pyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112934233 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-6-phenyl-2-pyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | COc1ccccc1CNc1cc(-c2ccccc2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C22H24N4O/c1-27-20-12-6-5-11-18(20)16-23-21-15-19(17-9-3-2-4-10-17)24-22(25-21)26-13-7-8-14-26/h2-6,9-12,15H,7-8,13-14,16H2,1H3,(H,23,24,25) |
| InChIKey | LRPXKKWIDMEPCH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |