C21H25N7O — CID 112935030
N-(2-methoxyethyl)-4-phenyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112935030) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-phenyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-(2-methoxyethyl)-4-phenyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112935030 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-(2-methoxyethyl)-4-phenyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | COCCNc1nc(-c2ccccc2)cc(N2CCN(c3ncccn3)CC2)n1 |
| InChI | InChI=1S/C21H25N7O/c1-29-15-10-22-20-25-18(17-6-3-2-4-7-17)16-19(26-20)27-11-13-28(14-12-27)21-23-8-5-9-24-21/h2-9,16H,10-15H2,1H3,(H,22,25,26) |
| InChIKey | ZWNLGVHOWJCBDC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|