C16H20N2O9S — CID 11293536
1-[8-(2,5-dioxopyrrol-1-yl)octanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 11293536) has the molecular formula C16H20N2O9S and a molecular weight of 416.41 g/mol. Its IUPAC name is 1-[8-(2,5-dioxopyrrol-1-yl)octanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[8-(2,5-dioxopyrrol-1-yl)octanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 11293536 |
| Molecular Formula | C16H20N2O9S |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 1-[8-(2,5-dioxopyrrol-1-yl)octanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | O=C(CCCCCCCN1C(=O)C=CC1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C16H20N2O9S/c19-12-7-8-13(20)17(12)9-5-3-1-2-4-6-15(22)27-18-14(21)10-11(16(18)23)28(24,25)26/h7-8,11H,1-6,9-10H2,(H,24,25,26) |
| InChIKey | PJAUWIPDQNYXOT-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|