C24H25N5O — CID 112936636
4-[4-(3,4-dihydro-2H-quinolin-1-yl)-6-phenylpyrimidin-2-yl]piperazine-1-carbaldehyde (PubChem CID 112936636) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-[4-(3,4-dihydro-2H-quinolin-1-yl)-6-phenylpyrimidin-2-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[4-(3,4-dihydro-2H-quinolin-1-yl)-6-phenylpyrimidin-2-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112936636 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 4-[4-(3,4-dihydro-2H-quinolin-1-yl)-6-phenylpyrimidin-2-yl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2nc(-c3ccccc3)cc(N3CCCc4ccccc43)n2)CC1 |
| InChI | InChI=1S/C24H25N5O/c30-18-27-13-15-28(16-14-27)24-25-21(19-7-2-1-3-8-19)17-23(26-24)29-12-6-10-20-9-4-5-11-22(20)29/h1-5,7-9,11,17-18H,6,10,12-16H2 |
| InChIKey | UOHKMIQBBNSTRQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|