C24H18FN5 — CID 112936986
2-[[4-[(2-fluorophenyl)methylamino]-6-phenylpyrimidin-2-yl]amino]benzonitrile (PubChem CID 112936986) has the molecular formula C24H18FN5 and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-[[4-[(2-fluorophenyl)methylamino]-6-phenylpyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 2-[[4-[(2-fluorophenyl)methylamino]-6-phenylpyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112936986 |
| Molecular Formula | C24H18FN5 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-[[4-[(2-fluorophenyl)methylamino]-6-phenylpyrimidin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccccc1Nc1nc(NCc2ccccc2F)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H18FN5/c25-20-12-6-4-11-19(20)16-27-23-14-22(17-8-2-1-3-9-17)29-24(30-23)28-21-13-7-5-10-18(21)15-26/h1-14H,16H2,(H2,27,28,29,30) |
| InChIKey | DMBYRCBXVQSGOH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |