About 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid
2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid (PubChem CID 11293771) has the molecular formula C27H26O4S
and a molecular weight of 446.57 g/mol. Its IUPAC name is 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid.
Molecular Properties
| Compound Name | 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid |
| PubChem CID | 11293771 |
| Molecular Formula | C27H26O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c(CCSCCC(c3ccccc3)c3ccccc3)coc12 |
| InChI | InChI=1S/C27H26O4S/c28-26(29)19-30-25-13-7-12-24-22(18-31-27(24)25)14-16-32-17-15-23(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,18,23H,14-17,19H2,(H,28,29) |
| InChIKey | PRUOHOABSYWLOL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid?
The IUPAC name of 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid (CID 11293771) is 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid.
What is the SMILES notation for 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid?
The canonical SMILES for 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid is O=C(O)COc1cccc2c(CCSCCC(c3ccccc3)c3ccccc3)coc12.
What is the InChIKey of 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid?
The InChIKey is PRUOHOABSYWLOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26O4S/c28-26(29)19-30-25-13-7-12-24-22(18-31-27(24)25)14-16-32-17-15-23(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,18,23H,14-17,19H2,(H,28,29).
What are the key properties of 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid?
2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid has a molecular weight of 446.57 g/mol, XLogP of 6.39, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-[2-(3,3-diphenylpropylsulfanyl)ethyl]-1-benzofuran-7-yl]oxy]acetic acid is sourced from PubChem (CID 11293771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).