C30H40O3 — CID 11293830
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,2R)-2-hydroxy-2-phenyloct-3-enoate (PubChem CID 11293830) has the molecular formula C30H40O3 and a molecular weight of 448.65 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,2R)-2-hydroxy-2-phenyloct-3-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,2R)-2-hydroxy-2-phenyloct-3-enoate |
|---|---|
| PubChem CID | 11293830 |
| Molecular Formula | C30H40O3 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,2R)-2-hydroxy-2-phenyloct-3-enoate |
| SMILES | CCCC/C=C/[C@](O)(C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H40O3/c1-5-6-7-14-21-30(32,25-17-12-9-13-18-25)28(31)33-27-22-23(2)19-20-26(27)29(3,4)24-15-10-8-11-16-24/h8-18,21,23,26-27,32H,5-7,19-20,22H2,1-4H3/b21-14+/t23-,26-,27-,30-/m1/s1 |
| InChIKey | CDBAYGGKEFGJGA-YJDPOYMTSA-N |
| XLogP | 6.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|