C14H15N5O2 — CID 112939431
methyl 4-[[3-(cyclopropylamino)-1,2,4-triazin-5-yl]amino]benzoate (PubChem CID 112939431) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is methyl 4-[[3-(cyclopropylamino)-1,2,4-triazin-5-yl]amino]benzoate.
| Compound Name | methyl 4-[[3-(cyclopropylamino)-1,2,4-triazin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 112939431 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | methyl 4-[[3-(cyclopropylamino)-1,2,4-triazin-5-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2cnnc(NC3CC3)n2)cc1 |
| InChI | InChI=1S/C14H15N5O2/c1-21-13(20)9-2-4-10(5-3-9)16-12-8-15-19-14(18-12)17-11-6-7-11/h2-5,8,11H,6-7H2,1H3,(H2,16,17,18,19) |
| InChIKey | ZIQNQDSRPLRFQY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |