C24H47NO3Si2 — CID 11293962
(1R,2S,8aS)-8a-butyl-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,5,8-tetrahydroindolizin-3-one (PubChem CID 11293962) has the molecular formula C24H47NO3Si2 and a molecular weight of 453.82 g/mol. Its IUPAC name is (1R,2S,8aS)-8a-butyl-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,5,8-tetrahydroindolizin-3-one.
| Compound Name | (1R,2S,8aS)-8a-butyl-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,5,8-tetrahydroindolizin-3-one |
|---|---|
| PubChem CID | 11293962 |
| Molecular Formula | C24H47NO3Si2 |
| Molecular Weight | 453.82 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | (1R,2S,8aS)-8a-butyl-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,5,8-tetrahydroindolizin-3-one |
| SMILES | CCCC[C@@]12CC=CCN1C(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H47NO3Si2/c1-12-13-16-24-17-14-15-18-25(24)21(26)19(27-29(8,9)22(2,3)4)20(24)28-30(10,11)23(5,6)7/h14-15,19-20H,12-13,16-18H2,1-11H3/t19-,20-,24-/m0/s1 |
| InChIKey | YFFYYTYAVKIQMU-SKPFHBQLSA-N |
| XLogP | 6.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.82 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|