C19H21N5O — CID 112940614
3-N-(2-methylpropyl)-5-N-(4-phenoxyphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112940614) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 3-N-(2-methylpropyl)-5-N-(4-phenoxyphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2-methylpropyl)-5-N-(4-phenoxyphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112940614 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-N-(2-methylpropyl)-5-N-(4-phenoxyphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CC(C)CNc1nncc(Nc2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C19H21N5O/c1-14(2)12-20-19-23-18(13-21-24-19)22-15-8-10-17(11-9-15)25-16-6-4-3-5-7-16/h3-11,13-14H,12H2,1-2H3,(H2,20,22,23,24) |
| InChIKey | KNNXAAJROPMAHR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |