C17H23N5O — CID 112941842
N-[2-(3-methoxyphenyl)ethyl]-5-piperidin-1-yl-1,2,4-triazin-3-amine (PubChem CID 112941842) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[2-(3-methoxyphenyl)ethyl]-5-piperidin-1-yl-1,2,4-triazin-3-amine.
| Compound Name | N-[2-(3-methoxyphenyl)ethyl]-5-piperidin-1-yl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112941842 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-[2-(3-methoxyphenyl)ethyl]-5-piperidin-1-yl-1,2,4-triazin-3-amine |
| SMILES | COc1cccc(CCNc2nncc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C17H23N5O/c1-23-15-7-5-6-14(12-15)8-9-18-17-20-16(13-19-21-17)22-10-3-2-4-11-22/h5-7,12-13H,2-4,8-11H2,1H3,(H,18,20,21) |
| InChIKey | YTKGULBUGASJTK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |