C32H48O2 — CID 11294232
(3R,8R,9S,10S,13S,14S)-3-benzyl-3-hexoxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 11294232) has the molecular formula C32H48O2 and a molecular weight of 464.73 g/mol. Its IUPAC name is (3R,8R,9S,10S,13S,14S)-3-benzyl-3-hexoxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,8R,9S,10S,13S,14S)-3-benzyl-3-hexoxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11294232 |
| Molecular Formula | C32H48O2 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.37 |
| IUPAC Name | (3R,8R,9S,10S,13S,14S)-3-benzyl-3-hexoxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCCCCCO[C@]1(Cc2ccccc2)CC[C@@]2(C)C(CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H48O2/c1-4-5-6-10-21-34-32(22-24-11-8-7-9-12-24)20-19-30(2)25(23-32)13-14-26-27-15-16-29(33)31(27,3)18-17-28(26)30/h7-9,11-12,25-28H,4-6,10,13-23H2,1-3H3/t25?,26-,27-,28-,30-,31-,32-/m0/s1 |
| InChIKey | YCOJNRQQLLTKFB-QQOHMFGNSA-N |
| XLogP | 8.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|