C17H23N5 — CID 112942468
3-N-cyclohexyl-5-N-ethyl-5-N-phenyl-1,2,4-triazine-3,5-diamine (PubChem CID 112942468) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 3-N-cyclohexyl-5-N-ethyl-5-N-phenyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-cyclohexyl-5-N-ethyl-5-N-phenyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112942468 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 3-N-cyclohexyl-5-N-ethyl-5-N-phenyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCN(c1ccccc1)c1cnnc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C17H23N5/c1-2-22(15-11-7-4-8-12-15)16-13-18-21-17(20-16)19-14-9-5-3-6-10-14/h4,7-8,11-14H,2-3,5-6,9-10H2,1H3,(H,19,20,21) |
| InChIKey | ITPVROGNMLYRGY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |