C14H24N6O3 — CID 112943340
ethyl 4-[[5-(2-methoxyethylamino)-1,2,4-triazin-3-yl]amino]piperidine-1-carboxylate (PubChem CID 112943340) has the molecular formula C14H24N6O3 and a molecular weight of 324.39 g/mol. Its IUPAC name is ethyl 4-[[5-(2-methoxyethylamino)-1,2,4-triazin-3-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-(2-methoxyethylamino)-1,2,4-triazin-3-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 112943340 |
| Molecular Formula | C14H24N6O3 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | ethyl 4-[[5-(2-methoxyethylamino)-1,2,4-triazin-3-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2nncc(NCCOC)n2)CC1 |
| InChI | InChI=1S/C14H24N6O3/c1-3-23-14(21)20-7-4-11(5-8-20)17-13-18-12(10-16-19-13)15-6-9-22-2/h10-11H,3-9H2,1-2H3,(H2,15,17,18,19) |
| InChIKey | OJKDCZYBCIAQLU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|