C12H13F2N5O — CID 112943475
3-N-(2,6-difluorophenyl)-5-N-(2-methoxyethyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112943475) has the molecular formula C12H13F2N5O and a molecular weight of 281.27 g/mol. Its IUPAC name is 3-N-(2,6-difluorophenyl)-5-N-(2-methoxyethyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2,6-difluorophenyl)-5-N-(2-methoxyethyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112943475 |
| Molecular Formula | C12H13F2N5O |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-N-(2,6-difluorophenyl)-5-N-(2-methoxyethyl)-1,2,4-triazine-3,5-diamine |
| SMILES | COCCNc1cnnc(Nc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C12H13F2N5O/c1-20-6-5-15-10-7-16-19-12(17-10)18-11-8(13)3-2-4-9(11)14/h2-4,7H,5-6H2,1H3,(H2,15,17,18,19) |
| InChIKey | UOXIHWIQLIEYKU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|