C15H21N5O2 — CID 112943782
3-N-(2-ethoxyphenyl)-5-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112943782) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-N-(2-ethoxyphenyl)-5-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2-ethoxyphenyl)-5-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112943782 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 3-N-(2-ethoxyphenyl)-5-N-(3-methoxypropyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CCOc1ccccc1Nc1nncc(NCCCOC)n1 |
| InChI | InChI=1S/C15H21N5O2/c1-3-22-13-8-5-4-7-12(13)18-15-19-14(11-17-20-15)16-9-6-10-21-2/h4-5,7-8,11H,3,6,9-10H2,1-2H3,(H2,16,18,19,20) |
| InChIKey | GYVIYMJJDAMMMC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|