C27H16N6OS — CID 11294402
3,4,14-triphenyl-8-thia-5,6,11,12,14,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,15-hexaen-10-one (PubChem CID 11294402) has the molecular formula C27H16N6OS and a molecular weight of 472.53 g/mol. Its IUPAC name is 3,4,14-triphenyl-8-thia-5,6,11,12,14,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,15-hexaen-10-one.
| Compound Name | 3,4,14-triphenyl-8-thia-5,6,11,12,14,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,15-hexaen-10-one |
|---|---|
| PubChem CID | 11294402 |
| Molecular Formula | C27H16N6OS |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 3,4,14-triphenyl-8-thia-5,6,11,12,14,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,15-hexaen-10-one |
| SMILES | O=c1c2sc3nnc(-c4ccccc4)c(-c4ccccc4)c3c2nc2n(-c3ccccc3)cnn12 |
| InChI | InChI=1S/C27H16N6OS/c34-26-24-23(29-27-32(16-28-33(26)27)19-14-8-3-9-15-19)21-20(17-10-4-1-5-11-17)22(30-31-25(21)35-24)18-12-6-2-7-13-18/h1-16H |
| InChIKey | CVVOIQQRXFFLTM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |