C16H21N5O3 — CID 112944091
N-[2-(4-methoxyphenoxy)ethyl]-5-morpholin-4-yl-1,2,4-triazin-3-amine (PubChem CID 112944091) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-5-morpholin-4-yl-1,2,4-triazin-3-amine.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-5-morpholin-4-yl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112944091 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-5-morpholin-4-yl-1,2,4-triazin-3-amine |
| SMILES | COc1ccc(OCCNc2nncc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C16H21N5O3/c1-22-13-2-4-14(5-3-13)24-9-6-17-16-19-15(12-18-20-16)21-7-10-23-11-8-21/h2-5,12H,6-11H2,1H3,(H,17,19,20) |
| InChIKey | ZPFRNOMOFHALEU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|