C27H31N3O3S — CID 11294521
2-[(2-ethoxybenzoyl)amino]-N-[3-(3-methylphenyl)propyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide (PubChem CID 11294521) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is 2-[(2-ethoxybenzoyl)amino]-N-[3-(3-methylphenyl)propyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide.
| Compound Name | 2-[(2-ethoxybenzoyl)amino]-N-[3-(3-methylphenyl)propyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
|---|---|
| PubChem CID | 11294521 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 2-[(2-ethoxybenzoyl)amino]-N-[3-(3-methylphenyl)propyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
| SMILES | CCOc1ccccc1C(=O)Nc1nc2c(s1)CCCC2C(=O)NCCCc1cccc(C)c1 |
| InChI | InChI=1S/C27H31N3O3S/c1-3-33-22-14-5-4-12-20(22)26(32)30-27-29-24-21(13-7-15-23(24)34-27)25(31)28-16-8-11-19-10-6-9-18(2)17-19/h4-6,9-10,12,14,17,21H,3,7-8,11,13,15-16H2,1-2H3,(H,28,31)(H,29,30,32) |
| InChIKey | FEMWWKACYFJZOX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|