C18H26N6 — CID 112946145
N-benzyl-N-ethyl-5-(4-ethylpiperazin-1-yl)-1,2,4-triazin-3-amine (PubChem CID 112946145) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is N-benzyl-N-ethyl-5-(4-ethylpiperazin-1-yl)-1,2,4-triazin-3-amine.
| Compound Name | N-benzyl-N-ethyl-5-(4-ethylpiperazin-1-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112946145 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | N-benzyl-N-ethyl-5-(4-ethylpiperazin-1-yl)-1,2,4-triazin-3-amine |
| SMILES | CCN1CCN(c2cnnc(N(CC)Cc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C18H26N6/c1-3-22-10-12-24(13-11-22)17-14-19-21-18(20-17)23(4-2)15-16-8-6-5-7-9-16/h5-9,14H,3-4,10-13,15H2,1-2H3 |
| InChIKey | GVGNEEVMLIRNMY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |