C29H38O4S — CID 11294631
[(3S,8S,9S,10R,13S,14S,16R,17S)-17-acetyl-16-(benzenesulfinyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 11294631) has the molecular formula C29H38O4S and a molecular weight of 482.69 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13S,14S,16R,17S)-17-acetyl-16-(benzenesulfinyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13S,14S,16R,17S)-17-acetyl-16-(benzenesulfinyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 11294631 |
| Molecular Formula | C29H38O4S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | [(3S,8S,9S,10R,13S,14S,16R,17S)-17-acetyl-16-(benzenesulfinyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4C[C@@H](S(=O)c5ccccc5)[C@H](C(C)=O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H38O4S/c1-18(30)27-26(34(32)22-8-6-5-7-9-22)17-25-23-11-10-20-16-21(33-19(2)31)12-14-28(20,3)24(23)13-15-29(25,27)4/h5-10,21,23-27H,11-17H2,1-4H3/t21-,23+,24-,25-,26+,27-,28-,29-,34?/m0/s1 |
| InChIKey | QUWJBSXIRSTNEZ-UZFFUSIISA-N |
| XLogP | 5.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|