C30H44O5 — CID 11294680
(1S,5R,7R)-4-hydroxy-3-[(Z)-3-hydroxy-3-methylbut-1-enyl]-8,8-dimethyl-5,7-bis(3-methylbut-2-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 11294680) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (1S,5R,7R)-4-hydroxy-3-[(Z)-3-hydroxy-3-methylbut-1-enyl]-8,8-dimethyl-5,7-bis(3-methylbut-2-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1S,5R,7R)-4-hydroxy-3-[(Z)-3-hydroxy-3-methylbut-1-enyl]-8,8-dimethyl-5,7-bis(3-methylbut-2-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 11294680 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (1S,5R,7R)-4-hydroxy-3-[(Z)-3-hydroxy-3-methylbut-1-enyl]-8,8-dimethyl-5,7-bis(3-methylbut-2-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | CC(C)=CC[C@@H]1C[C@@]2(CC=C(C)C)C(=O)[C@](C(=O)C(C)C)(C(=O)C(/C=C\C(C)(C)O)=C2O)C1(C)C |
| InChI | InChI=1S/C30H44O5/c1-18(2)11-12-21-17-29(16-13-19(3)4)24(32)22(14-15-27(7,8)35)25(33)30(26(29)34,28(21,9)10)23(31)20(5)6/h11,13-15,20-21,32,35H,12,16-17H2,1-10H3/b15-14-/t21-,29-,30+/m1/s1 |
| InChIKey | MSVZJGVMPBGWLG-JQCAVCAVSA-N |
| XLogP | 6.23 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|